C21H33N3O3 — CID 121161250
(4-butylcyclohexyl)-[4-(2-methoxypyrimidin-4-yl)oxypiperidin-1-yl]methanone (PubChem CID 121161250) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is (4-butylcyclohexyl)-[4-(2-methoxypyrimidin-4-yl)oxypiperidin-1-yl]methanone.
| Compound Name | (4-butylcyclohexyl)-[4-(2-methoxypyrimidin-4-yl)oxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 121161250 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | (4-butylcyclohexyl)-[4-(2-methoxypyrimidin-4-yl)oxypiperidin-1-yl]methanone |
| SMILES | CCCCC1CCC(C(=O)N2CCC(Oc3ccnc(OC)n3)CC2)CC1 |
| InChI | InChI=1S/C21H33N3O3/c1-3-4-5-16-6-8-17(9-7-16)20(25)24-14-11-18(12-15-24)27-19-10-13-22-21(23-19)26-2/h10,13,16-18H,3-9,11-12,14-15H2,1-2H3 |
| InChIKey | BXTBMKYYGXBZSM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |