C20H20FN5O2S — CID 121163128
2-(4-fluorophenyl)sulfanyl-1-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxypiperidin-1-yl]ethanone (PubChem CID 121163128) has the molecular formula C20H20FN5O2S and a molecular weight of 413.48 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfanyl-1-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxypiperidin-1-yl]ethanone.
| Compound Name | 2-(4-fluorophenyl)sulfanyl-1-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxypiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 121163128 |
| Molecular Formula | C20H20FN5O2S |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 2-(4-fluorophenyl)sulfanyl-1-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxypiperidin-1-yl]ethanone |
| SMILES | O=C(CSc1ccc(F)cc1)N1CCC(Oc2ccc(-n3cccn3)nn2)CC1 |
| InChI | InChI=1S/C20H20FN5O2S/c21-15-2-4-17(5-3-15)29-14-20(27)25-12-8-16(9-13-25)28-19-7-6-18(23-24-19)26-11-1-10-22-26/h1-7,10-11,16H,8-9,12-14H2 |
| InChIKey | MGHOKPNYEIKLCZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |