C20H20FN5O3 — CID 121163245
(3-fluoro-4-methoxyphenyl)-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxypiperidin-1-yl]methanone (PubChem CID 121163245) has the molecular formula C20H20FN5O3 and a molecular weight of 397.41 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxypiperidin-1-yl]methanone.
| Compound Name | (3-fluoro-4-methoxyphenyl)-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 121163245 |
| Molecular Formula | C20H20FN5O3 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxypiperidin-1-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCC(Oc3ccc(-n4cccn4)nn3)CC2)cc1F |
| InChI | InChI=1S/C20H20FN5O3/c1-28-17-4-3-14(13-16(17)21)20(27)25-11-7-15(8-12-25)29-19-6-5-18(23-24-19)26-10-2-9-22-26/h2-6,9-10,13,15H,7-8,11-12H2,1H3 |
| InChIKey | RPWCFEVWUAWFDO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |