About [7-(2-methylphenyl)-1,4-thiazepan-4-yl]-[3-(trifluoromethyl)phenyl]methanone
[7-(2-methylphenyl)-1,4-thiazepan-4-yl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 121163717) has the molecular formula C20H20F3NOS
and a molecular weight of 379.45 g/mol. Its IUPAC name is [7-(2-methylphenyl)-1,4-thiazepan-4-yl]-[3-(trifluoromethyl)phenyl]methanone.
Molecular Properties
| Compound Name | [7-(2-methylphenyl)-1,4-thiazepan-4-yl]-[3-(trifluoromethyl)phenyl]methanone |
| PubChem CID | 121163717 |
| Molecular Formula | C20H20F3NOS |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | [7-(2-methylphenyl)-1,4-thiazepan-4-yl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | Cc1ccccc1C1CCN(C(=O)c2cccc(C(F)(F)F)c2)CCS1 |
| InChI | InChI=1S/C20H20F3NOS/c1-14-5-2-3-8-17(14)18-9-10-24(11-12-26-18)19(25)15-6-4-7-16(13-15)20(21,22)23/h2-8,13,18H,9-12H2,1H3 |
| InChIKey | SIOBYLHTNRZZNT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [7-(2-methylphenyl)-1,4-thiazepan-4-yl]-[3-(trifluoromethyl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(2-methylphenyl)-1,4-thiazepan-4-yl]-[3-(trifluoromethyl)phenyl]methanone?
The IUPAC name of [7-(2-methylphenyl)-1,4-thiazepan-4-yl]-[3-(trifluoromethyl)phenyl]methanone (CID 121163717) is [7-(2-methylphenyl)-1,4-thiazepan-4-yl]-[3-(trifluoromethyl)phenyl]methanone.
What is the SMILES notation for [7-(2-methylphenyl)-1,4-thiazepan-4-yl]-[3-(trifluoromethyl)phenyl]methanone?
The canonical SMILES for [7-(2-methylphenyl)-1,4-thiazepan-4-yl]-[3-(trifluoromethyl)phenyl]methanone is Cc1ccccc1C1CCN(C(=O)c2cccc(C(F)(F)F)c2)CCS1.
What is the InChIKey of [7-(2-methylphenyl)-1,4-thiazepan-4-yl]-[3-(trifluoromethyl)phenyl]methanone?
The InChIKey is SIOBYLHTNRZZNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F3NOS/c1-14-5-2-3-8-17(14)18-9-10-24(11-12-26-18)19(25)15-6-4-7-16(13-15)20(21,22)23/h2-8,13,18H,9-12H2,1H3.
What are the key properties of [7-(2-methylphenyl)-1,4-thiazepan-4-yl]-[3-(trifluoromethyl)phenyl]methanone?
[7-(2-methylphenyl)-1,4-thiazepan-4-yl]-[3-(trifluoromethyl)phenyl]methanone has a molecular weight of 379.45 g/mol, XLogP of 5.33, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(2-methylphenyl)-1,4-thiazepan-4-yl]-[3-(trifluoromethyl)phenyl]methanone is sourced from PubChem (CID 121163717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).