About 3-ethylsulfonyl-N,N-dimethylazetidine-1-sulfonamide
3-ethylsulfonyl-N,N-dimethylazetidine-1-sulfonamide (PubChem CID 121164691) has the molecular formula C7H16N2O4S2
and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-ethylsulfonyl-N,N-dimethylazetidine-1-sulfonamide.
Molecular Properties
| Compound Name | 3-ethylsulfonyl-N,N-dimethylazetidine-1-sulfonamide |
| PubChem CID | 121164691 |
| Molecular Formula | C7H16N2O4S2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 3-ethylsulfonyl-N,N-dimethylazetidine-1-sulfonamide |
| SMILES | CCS(=O)(=O)C1CN(S(=O)(=O)N(C)C)C1 |
| InChI | InChI=1S/C7H16N2O4S2/c1-4-14(10,11)7-5-9(6-7)15(12,13)8(2)3/h7H,4-6H2,1-3H3 |
| InChIKey | RUSUEPKSZNOIRN-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethylsulfonyl-N,N-dimethylazetidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylsulfonyl-N,N-dimethylazetidine-1-sulfonamide?
The IUPAC name of 3-ethylsulfonyl-N,N-dimethylazetidine-1-sulfonamide (CID 121164691) is 3-ethylsulfonyl-N,N-dimethylazetidine-1-sulfonamide.
What is the SMILES notation for 3-ethylsulfonyl-N,N-dimethylazetidine-1-sulfonamide?
The canonical SMILES for 3-ethylsulfonyl-N,N-dimethylazetidine-1-sulfonamide is CCS(=O)(=O)C1CN(S(=O)(=O)N(C)C)C1.
What is the InChIKey of 3-ethylsulfonyl-N,N-dimethylazetidine-1-sulfonamide?
The InChIKey is RUSUEPKSZNOIRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O4S2/c1-4-14(10,11)7-5-9(6-7)15(12,13)8(2)3/h7H,4-6H2,1-3H3.
What are the key properties of 3-ethylsulfonyl-N,N-dimethylazetidine-1-sulfonamide?
3-ethylsulfonyl-N,N-dimethylazetidine-1-sulfonamide has a molecular weight of 256.35 g/mol, XLogP of -1.09, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylsulfonyl-N,N-dimethylazetidine-1-sulfonamide is sourced from PubChem (CID 121164691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).