C21H23N7O3 — CID 121164907
6-(2-methoxyethyl)-5-[4-(triazol-2-yl)piperidine-1-carbonyl]-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one (PubChem CID 121164907) has the molecular formula C21H23N7O3 and a molecular weight of 421.46 g/mol. Its IUPAC name is 6-(2-methoxyethyl)-5-[4-(triazol-2-yl)piperidine-1-carbonyl]-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one.
| Compound Name | 6-(2-methoxyethyl)-5-[4-(triazol-2-yl)piperidine-1-carbonyl]-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one |
|---|---|
| PubChem CID | 121164907 |
| Molecular Formula | C21H23N7O3 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 6-(2-methoxyethyl)-5-[4-(triazol-2-yl)piperidine-1-carbonyl]-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one |
| SMILES | COCCn1c(C(=O)N2CCC(n3nccn3)CC2)cc2c(=O)n3ccccc3nc21 |
| InChI | InChI=1S/C21H23N7O3/c1-31-13-12-26-17(14-16-19(26)24-18-4-2-3-9-27(18)20(16)29)21(30)25-10-5-15(6-11-25)28-22-7-8-23-28/h2-4,7-9,14-15H,5-6,10-13H2,1H3 |
| InChIKey | KAOKZIJEZLBTMP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 99.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |