C18H22N4O2 — CID 121167503
(4-benzylpiperazin-1-yl)-(6-ethoxypyrimidin-4-yl)methanone (PubChem CID 121167503) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-(6-ethoxypyrimidin-4-yl)methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-(6-ethoxypyrimidin-4-yl)methanone |
|---|---|
| PubChem CID | 121167503 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-(6-ethoxypyrimidin-4-yl)methanone |
| SMILES | CCOc1cc(C(=O)N2CCN(Cc3ccccc3)CC2)ncn1 |
| InChI | InChI=1S/C18H22N4O2/c1-2-24-17-12-16(19-14-20-17)18(23)22-10-8-21(9-11-22)13-15-6-4-3-5-7-15/h3-7,12,14H,2,8-11,13H2,1H3 |
| InChIKey | YPMRTRMHWVRXDZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |