4-(5-methyl-1,3-dioxoisoindol-2-yl)benzoic acid

C16H11NO4 — CID 1211699

IUPAC4-(5-methyl-1,3-dioxoisoindol-2-yl)benzoic acid
SMILESCc1ccc2c(c1)C(=O)N(c1ccc(C(=O)O)cc1)C2=O
InChIInChI=1S/C16H11NO4/c1-9-2-7-12-13(8-9)15(19)17(14(12)18)11-5-3-10(4-6-11)16(20)21/h2-8H,1H3,(H,20,21)
InChIKeyHENFOGMTHOCWFJ-UHFFFAOYSA-N
MW281.27 g/mol
LogP2.49
Rot. Bonds2

About 4-(5-methyl-1,3-dioxoisoindol-2-yl)benzoic acid

4-(5-methyl-1,3-dioxoisoindol-2-yl)benzoic acid (PubChem CID 1211699) has the molecular formula C16H11NO4 and a molecular weight of 281.27 g/mol. Its IUPAC name is 4-(5-methyl-1,3-dioxoisoindol-2-yl)benzoic acid.

Molecular Properties

Compound Name4-(5-methyl-1,3-dioxoisoindol-2-yl)benzoic acid
PubChem CID1211699
Molecular FormulaC16H11NO4
Molecular Weight281.27 g/mol
Exact Mass281.07
IUPAC Name4-(5-methyl-1,3-dioxoisoindol-2-yl)benzoic acid
SMILESCc1ccc2c(c1)C(=O)N(c1ccc(C(=O)O)cc1)C2=O
InChIInChI=1S/C16H11NO4/c1-9-2-7-12-13(8-9)15(19)17(14(12)18)11-5-3-10(4-6-11)16(20)21/h2-8H,1H3,(H,20,21)
InChIKeyHENFOGMTHOCWFJ-UHFFFAOYSA-N
XLogP2.49
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.27
LogP ≤ 52.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 4-(5-methyl-1,3-dioxoisoindol-2-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(5-methyl-1,3-dioxoisoindol-2-yl)benzoic acid?
The IUPAC name of 4-(5-methyl-1,3-dioxoisoindol-2-yl)benzoic acid (CID 1211699) is 4-(5-methyl-1,3-dioxoisoindol-2-yl)benzoic acid.
What is the SMILES notation for 4-(5-methyl-1,3-dioxoisoindol-2-yl)benzoic acid?
The canonical SMILES for 4-(5-methyl-1,3-dioxoisoindol-2-yl)benzoic acid is Cc1ccc2c(c1)C(=O)N(c1ccc(C(=O)O)cc1)C2=O.
What is the InChIKey of 4-(5-methyl-1,3-dioxoisoindol-2-yl)benzoic acid?
The InChIKey is HENFOGMTHOCWFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO4/c1-9-2-7-12-13(8-9)15(19)17(14(12)18)11-5-3-10(4-6-11)16(20)21/h2-8H,1H3,(H,20,21).
What are the key properties of 4-(5-methyl-1,3-dioxoisoindol-2-yl)benzoic acid?
4-(5-methyl-1,3-dioxoisoindol-2-yl)benzoic acid has a molecular weight of 281.27 g/mol, XLogP of 2.49, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methyl-1,3-dioxoisoindol-2-yl)benzoic acid is sourced from PubChem (CID 1211699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).