C20H24N4O2S — CID 121169901
1-[2-(4-methoxyphenyl)ethyl]-3-[2-(5-methyl-3-thiophen-2-ylpyrazol-1-yl)ethyl]urea (PubChem CID 121169901) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)ethyl]-3-[2-(5-methyl-3-thiophen-2-ylpyrazol-1-yl)ethyl]urea.
| Compound Name | 1-[2-(4-methoxyphenyl)ethyl]-3-[2-(5-methyl-3-thiophen-2-ylpyrazol-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 121169901 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)ethyl]-3-[2-(5-methyl-3-thiophen-2-ylpyrazol-1-yl)ethyl]urea |
| SMILES | COc1ccc(CCNC(=O)NCCn2nc(-c3cccs3)cc2C)cc1 |
| InChI | InChI=1S/C20H24N4O2S/c1-15-14-18(19-4-3-13-27-19)23-24(15)12-11-22-20(25)21-10-9-16-5-7-17(26-2)8-6-16/h3-8,13-14H,9-12H2,1-2H3,(H2,21,22,25) |
| InChIKey | FKRCBCWKQKMZQL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |