C20H17N5O2 — CID 121176253
5-phenyl-N-[1-phenyl-2-(triazol-2-yl)ethyl]-1,2-oxazole-3-carboxamide (PubChem CID 121176253) has the molecular formula C20H17N5O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is 5-phenyl-N-[1-phenyl-2-(triazol-2-yl)ethyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-phenyl-N-[1-phenyl-2-(triazol-2-yl)ethyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 121176253 |
| Molecular Formula | C20H17N5O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 5-phenyl-N-[1-phenyl-2-(triazol-2-yl)ethyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NC(Cn1nccn1)c1ccccc1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C20H17N5O2/c26-20(17-13-19(27-24-17)16-9-5-2-6-10-16)23-18(14-25-21-11-12-22-25)15-7-3-1-4-8-15/h1-13,18H,14H2,(H,23,26) |
| InChIKey | ZLUXFPYLGZILDQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |