C19H21N5O3S — CID 121176289
2-[(3-methylphenyl)sulfonylamino]-N-[1-phenyl-2-(triazol-2-yl)ethyl]acetamide (PubChem CID 121176289) has the molecular formula C19H21N5O3S and a molecular weight of 399.48 g/mol. Its IUPAC name is 2-[(3-methylphenyl)sulfonylamino]-N-[1-phenyl-2-(triazol-2-yl)ethyl]acetamide.
| Compound Name | 2-[(3-methylphenyl)sulfonylamino]-N-[1-phenyl-2-(triazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 121176289 |
| Molecular Formula | C19H21N5O3S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2-[(3-methylphenyl)sulfonylamino]-N-[1-phenyl-2-(triazol-2-yl)ethyl]acetamide |
| SMILES | Cc1cccc(S(=O)(=O)NCC(=O)NC(Cn2nccn2)c2ccccc2)c1 |
| InChI | InChI=1S/C19H21N5O3S/c1-15-6-5-9-17(12-15)28(26,27)22-13-19(25)23-18(14-24-20-10-11-21-24)16-7-3-2-4-8-16/h2-12,18,22H,13-14H2,1H3,(H,23,25) |
| InChIKey | IJVCWIUAZFIROR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |