C18H19N5O2 — CID 121176489
1-(2-methoxyphenyl)-3-[1-phenyl-2-(triazol-2-yl)ethyl]urea (PubChem CID 121176489) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[1-phenyl-2-(triazol-2-yl)ethyl]urea.
| Compound Name | 1-(2-methoxyphenyl)-3-[1-phenyl-2-(triazol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 121176489 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[1-phenyl-2-(triazol-2-yl)ethyl]urea |
| SMILES | COc1ccccc1NC(=O)NC(Cn1nccn1)c1ccccc1 |
| InChI | InChI=1S/C18H19N5O2/c1-25-17-10-6-5-9-15(17)21-18(24)22-16(13-23-19-11-12-20-23)14-7-3-2-4-8-14/h2-12,16H,13H2,1H3,(H2,21,22,24) |
| InChIKey | MDXLTZCIHNNKIT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |