C11H12N2O2S2 — CID 121177877
N-[(2-thiophen-3-yl-3-pyridinyl)methyl]methanesulfonamide (PubChem CID 121177877) has the molecular formula C11H12N2O2S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is N-[(2-thiophen-3-yl-3-pyridinyl)methyl]methanesulfonamide.
| Compound Name | N-[(2-thiophen-3-yl-3-pyridinyl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 121177877 |
| Molecular Formula | C11H12N2O2S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | N-[(2-thiophen-3-yl-3-pyridinyl)methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCc1cccnc1-c1ccsc1 |
| InChI | InChI=1S/C11H12N2O2S2/c1-17(14,15)13-7-9-3-2-5-12-11(9)10-4-6-16-8-10/h2-6,8,13H,7H2,1H3 |
| InChIKey | VQIKMCZMXXJHAL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |