C16H19N5O2 — CID 121178262
(6-methoxy-3-pyridinyl)-[3-(triazol-2-yl)-8-azabicyclo[3.2.1]octan-8-yl]methanone (PubChem CID 121178262) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is (6-methoxy-3-pyridinyl)-[3-(triazol-2-yl)-8-azabicyclo[3.2.1]octan-8-yl]methanone.
| Compound Name | (6-methoxy-3-pyridinyl)-[3-(triazol-2-yl)-8-azabicyclo[3.2.1]octan-8-yl]methanone |
|---|---|
| PubChem CID | 121178262 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (6-methoxy-3-pyridinyl)-[3-(triazol-2-yl)-8-azabicyclo[3.2.1]octan-8-yl]methanone |
| SMILES | COc1ccc(C(=O)N2C3CCC2CC(n2nccn2)C3)cn1 |
| InChI | InChI=1S/C16H19N5O2/c1-23-15-5-2-11(10-17-15)16(22)20-12-3-4-13(20)9-14(8-12)21-18-6-7-19-21/h2,5-7,10,12-14H,3-4,8-9H2,1H3 |
| InChIKey | UJHIYNAGGWJTGE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |