C11H14N4O — CID 121183340
N-prop-2-enyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxamide (PubChem CID 121183340) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is N-prop-2-enyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-prop-2-enyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 121183340 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | N-prop-2-enyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxamide |
| SMILES | C=CCNC(=O)N1CCc2ncncc2C1 |
| InChI | InChI=1S/C11H14N4O/c1-2-4-13-11(16)15-5-3-10-9(7-15)6-12-8-14-10/h2,6,8H,1,3-5,7H2,(H,13,16) |
| InChIKey | LRTSRJIVZJYLLP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|