C12H15N3 — CID 121183365
12-prop-2-enyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 121183365) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 12-prop-2-enyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | 12-prop-2-enyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 121183365 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 12-prop-2-enyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | C=CCN1C2CCC1c1cncnc1C2 |
| InChI | InChI=1S/C12H15N3/c1-2-5-15-9-3-4-12(15)10-7-13-8-14-11(10)6-9/h2,7-9,12H,1,3-6H2 |
| InChIKey | BGJMXODESLYVTP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|