About 8-[(1,3-dimethylpyrazol-4-yl)methyl]-8-azabicyclo[3.2.1]oct-2-ene
8-[(1,3-dimethylpyrazol-4-yl)methyl]-8-azabicyclo[3.2.1]oct-2-ene (PubChem CID 121183482) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is 8-[(1,3-dimethylpyrazol-4-yl)methyl]-8-azabicyclo[3.2.1]oct-2-ene.
Molecular Properties
| Compound Name | 8-[(1,3-dimethylpyrazol-4-yl)methyl]-8-azabicyclo[3.2.1]oct-2-ene |
| PubChem CID | 121183482 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 8-[(1,3-dimethylpyrazol-4-yl)methyl]-8-azabicyclo[3.2.1]oct-2-ene |
| SMILES | Cc1nn(C)cc1CN1C2C=CCC1CC2 |
| InChI | InChI=1S/C13H19N3/c1-10-11(8-15(2)14-10)9-16-12-4-3-5-13(16)7-6-12/h3-4,8,12-13H,5-7,9H2,1-2H3 |
| InChIKey | NRGRDGBGJVORBD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-[(1,3-dimethylpyrazol-4-yl)methyl]-8-azabicyclo[3.2.1]oct-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(1,3-dimethylpyrazol-4-yl)methyl]-8-azabicyclo[3.2.1]oct-2-ene?
The IUPAC name of 8-[(1,3-dimethylpyrazol-4-yl)methyl]-8-azabicyclo[3.2.1]oct-2-ene (CID 121183482) is 8-[(1,3-dimethylpyrazol-4-yl)methyl]-8-azabicyclo[3.2.1]oct-2-ene.
What is the SMILES notation for 8-[(1,3-dimethylpyrazol-4-yl)methyl]-8-azabicyclo[3.2.1]oct-2-ene?
The canonical SMILES for 8-[(1,3-dimethylpyrazol-4-yl)methyl]-8-azabicyclo[3.2.1]oct-2-ene is Cc1nn(C)cc1CN1C2C=CCC1CC2.
What is the InChIKey of 8-[(1,3-dimethylpyrazol-4-yl)methyl]-8-azabicyclo[3.2.1]oct-2-ene?
The InChIKey is NRGRDGBGJVORBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3/c1-10-11(8-15(2)14-10)9-16-12-4-3-5-13(16)7-6-12/h3-4,8,12-13H,5-7,9H2,1-2H3.
What are the key properties of 8-[(1,3-dimethylpyrazol-4-yl)methyl]-8-azabicyclo[3.2.1]oct-2-ene?
8-[(1,3-dimethylpyrazol-4-yl)methyl]-8-azabicyclo[3.2.1]oct-2-ene has a molecular weight of 217.32 g/mol, XLogP of 2.02, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(1,3-dimethylpyrazol-4-yl)methyl]-8-azabicyclo[3.2.1]oct-2-ene is sourced from PubChem (CID 121183482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).