C13H16N4O2 — CID 121184009
3-[1-(3-methyl-2-pyridinyl)pyrrolidin-3-yl]imidazolidine-2,4-dione (PubChem CID 121184009) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 3-[1-(3-methyl-2-pyridinyl)pyrrolidin-3-yl]imidazolidine-2,4-dione.
| Compound Name | 3-[1-(3-methyl-2-pyridinyl)pyrrolidin-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121184009 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 3-[1-(3-methyl-2-pyridinyl)pyrrolidin-3-yl]imidazolidine-2,4-dione |
| SMILES | Cc1cccnc1N1CCC(N2C(=O)CNC2=O)C1 |
| InChI | InChI=1S/C13H16N4O2/c1-9-3-2-5-14-12(9)16-6-4-10(8-16)17-11(18)7-15-13(17)19/h2-3,5,10H,4,6-8H2,1H3,(H,15,19) |
| InChIKey | MZTXXXZITMHPQT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|