About 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl(1H-indol-6-yl)methanone
5,7-dihydropyrrolo[3,4-b]pyridin-6-yl(1H-indol-6-yl)methanone (PubChem CID 121184526) has the molecular formula C16H13N3O
and a molecular weight of 263.30 g/mol. Its IUPAC name is 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl(1H-indol-6-yl)methanone.
Molecular Properties
| Compound Name | 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl(1H-indol-6-yl)methanone |
| PubChem CID | 121184526 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl(1H-indol-6-yl)methanone |
| SMILES | O=C(c1ccc2cc[nH]c2c1)N1Cc2cccnc2C1 |
| InChI | InChI=1S/C16H13N3O/c20-16(12-4-3-11-5-7-18-14(11)8-12)19-9-13-2-1-6-17-15(13)10-19/h1-8,18H,9-10H2 |
| InChIKey | FRGGZIMOAZARSM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl(1H-indol-6-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl(1H-indol-6-yl)methanone?
The IUPAC name of 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl(1H-indol-6-yl)methanone (CID 121184526) is 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl(1H-indol-6-yl)methanone.
What is the SMILES notation for 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl(1H-indol-6-yl)methanone?
The canonical SMILES for 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl(1H-indol-6-yl)methanone is O=C(c1ccc2cc[nH]c2c1)N1Cc2cccnc2C1.
What is the InChIKey of 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl(1H-indol-6-yl)methanone?
The InChIKey is FRGGZIMOAZARSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O/c20-16(12-4-3-11-5-7-18-14(11)8-12)19-9-13-2-1-6-17-15(13)10-19/h1-8,18H,9-10H2.
What are the key properties of 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl(1H-indol-6-yl)methanone?
5,7-dihydropyrrolo[3,4-b]pyridin-6-yl(1H-indol-6-yl)methanone has a molecular weight of 263.30 g/mol, XLogP of 2.72, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl(1H-indol-6-yl)methanone is sourced from PubChem (CID 121184526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).