About 3-[(4,4-difluoropiperidin-1-yl)methyl]-1,2,4-oxadiazole
3-[(4,4-difluoropiperidin-1-yl)methyl]-1,2,4-oxadiazole (PubChem CID 121184647) has the molecular formula C8H11F2N3O
and a molecular weight of 203.19 g/mol. Its IUPAC name is 3-[(4,4-difluoropiperidin-1-yl)methyl]-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-[(4,4-difluoropiperidin-1-yl)methyl]-1,2,4-oxadiazole |
| PubChem CID | 121184647 |
| Molecular Formula | C8H11F2N3O |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 3-[(4,4-difluoropiperidin-1-yl)methyl]-1,2,4-oxadiazole |
| SMILES | FC1(F)CCN(Cc2ncon2)CC1 |
| InChI | InChI=1S/C8H11F2N3O/c9-8(10)1-3-13(4-2-8)5-7-11-6-14-12-7/h6H,1-5H2 |
| InChIKey | UEKKFYIMHZELHI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4,4-difluoropiperidin-1-yl)methyl]-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,4-difluoropiperidin-1-yl)methyl]-1,2,4-oxadiazole?
The IUPAC name of 3-[(4,4-difluoropiperidin-1-yl)methyl]-1,2,4-oxadiazole (CID 121184647) is 3-[(4,4-difluoropiperidin-1-yl)methyl]-1,2,4-oxadiazole.
What is the SMILES notation for 3-[(4,4-difluoropiperidin-1-yl)methyl]-1,2,4-oxadiazole?
The canonical SMILES for 3-[(4,4-difluoropiperidin-1-yl)methyl]-1,2,4-oxadiazole is FC1(F)CCN(Cc2ncon2)CC1.
What is the InChIKey of 3-[(4,4-difluoropiperidin-1-yl)methyl]-1,2,4-oxadiazole?
The InChIKey is UEKKFYIMHZELHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F2N3O/c9-8(10)1-3-13(4-2-8)5-7-11-6-14-12-7/h6H,1-5H2.
What are the key properties of 3-[(4,4-difluoropiperidin-1-yl)methyl]-1,2,4-oxadiazole?
3-[(4,4-difluoropiperidin-1-yl)methyl]-1,2,4-oxadiazole has a molecular weight of 203.19 g/mol, XLogP of 1.30, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,4-difluoropiperidin-1-yl)methyl]-1,2,4-oxadiazole is sourced from PubChem (CID 121184647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).