C11H18F2N2O2 — CID 121184666
4,4-difluoro-N-(oxolan-2-ylmethyl)piperidine-1-carboxamide (PubChem CID 121184666) has the molecular formula C11H18F2N2O2 and a molecular weight of 248.27 g/mol. Its IUPAC name is 4,4-difluoro-N-(oxolan-2-ylmethyl)piperidine-1-carboxamide.
| Compound Name | 4,4-difluoro-N-(oxolan-2-ylmethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 121184666 |
| Molecular Formula | C11H18F2N2O2 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 4,4-difluoro-N-(oxolan-2-ylmethyl)piperidine-1-carboxamide |
| SMILES | O=C(NCC1CCCO1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H18F2N2O2/c12-11(13)3-5-15(6-4-11)10(16)14-8-9-2-1-7-17-9/h9H,1-8H2,(H,14,16) |
| InChIKey | HIHCVBLMVPDWRI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |