About 1-ethylsulfonyl-4,4-difluoropiperidine
1-ethylsulfonyl-4,4-difluoropiperidine (PubChem CID 121184667) has the molecular formula C7H13F2NO2S
and a molecular weight of 213.25 g/mol. Its IUPAC name is 1-ethylsulfonyl-4,4-difluoropiperidine.
Molecular Properties
| Compound Name | 1-ethylsulfonyl-4,4-difluoropiperidine |
| PubChem CID | 121184667 |
| Molecular Formula | C7H13F2NO2S |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 1-ethylsulfonyl-4,4-difluoropiperidine |
| SMILES | CCS(=O)(=O)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C7H13F2NO2S/c1-2-13(11,12)10-5-3-7(8,9)4-6-10/h2-6H2,1H3 |
| InChIKey | FLIBUGQCLGMXRH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethylsulfonyl-4,4-difluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylsulfonyl-4,4-difluoropiperidine?
The IUPAC name of 1-ethylsulfonyl-4,4-difluoropiperidine (CID 121184667) is 1-ethylsulfonyl-4,4-difluoropiperidine.
What is the SMILES notation for 1-ethylsulfonyl-4,4-difluoropiperidine?
The canonical SMILES for 1-ethylsulfonyl-4,4-difluoropiperidine is CCS(=O)(=O)N1CCC(F)(F)CC1.
What is the InChIKey of 1-ethylsulfonyl-4,4-difluoropiperidine?
The InChIKey is FLIBUGQCLGMXRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F2NO2S/c1-2-13(11,12)10-5-3-7(8,9)4-6-10/h2-6H2,1H3.
What are the key properties of 1-ethylsulfonyl-4,4-difluoropiperidine?
1-ethylsulfonyl-4,4-difluoropiperidine has a molecular weight of 213.25 g/mol, XLogP of 1.07, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylsulfonyl-4,4-difluoropiperidine is sourced from PubChem (CID 121184667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).