C12H16N4O — CID 121185264
(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-pyrimidin-2-ylmethanone (PubChem CID 121185264) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is (2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-pyrimidin-2-ylmethanone.
| Compound Name | (2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-pyrimidin-2-ylmethanone |
|---|---|
| PubChem CID | 121185264 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-pyrimidin-2-ylmethanone |
| SMILES | CN1CC2CN(C(=O)c3ncccn3)CC2C1 |
| InChI | InChI=1S/C12H16N4O/c1-15-5-9-7-16(8-10(9)6-15)12(17)11-13-3-2-4-14-11/h2-4,9-10H,5-8H2,1H3 |
| InChIKey | OEENZYIPMCQBQF-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |