C14H17N3O — CID 121185299
4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)furo[3,2-c]pyridine (PubChem CID 121185299) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)furo[3,2-c]pyridine.
| Compound Name | 4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)furo[3,2-c]pyridine |
|---|---|
| PubChem CID | 121185299 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)furo[3,2-c]pyridine |
| SMILES | CN1CC2CN(c3nccc4occc34)CC2C1 |
| InChI | InChI=1S/C14H17N3O/c1-16-6-10-8-17(9-11(10)7-16)14-12-3-5-18-13(12)2-4-15-14/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | BEDWHAKICPSELK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |