C14H17N3S — CID 121185327
2-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-1,3-benzothiazole (PubChem CID 121185327) has the molecular formula C14H17N3S and a molecular weight of 259.38 g/mol. Its IUPAC name is 2-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-1,3-benzothiazole.
| Compound Name | 2-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 121185327 |
| Molecular Formula | C14H17N3S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-1,3-benzothiazole |
| SMILES | CN1CC2CN(c3nc4ccccc4s3)CC2C1 |
| InChI | InChI=1S/C14H17N3S/c1-16-6-10-8-17(9-11(10)7-16)14-15-12-4-2-3-5-13(12)18-14/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | XAFOJYQREUITTR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |