C12H18N4S — CID 121185568
2-(2-cyclopropyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-5-methyl-1,3,4-thiadiazole (PubChem CID 121185568) has the molecular formula C12H18N4S and a molecular weight of 250.37 g/mol. Its IUPAC name is 2-(2-cyclopropyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-5-methyl-1,3,4-thiadiazole.
| Compound Name | 2-(2-cyclopropyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-5-methyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 121185568 |
| Molecular Formula | C12H18N4S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 2-(2-cyclopropyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-5-methyl-1,3,4-thiadiazole |
| SMILES | Cc1nnc(N2CC3CN(C4CC4)CC3C2)s1 |
| InChI | InChI=1S/C12H18N4S/c1-8-13-14-12(17-8)16-6-9-4-15(11-2-3-11)5-10(9)7-16/h9-11H,2-7H2,1H3 |
| InChIKey | SPOMFFNCMASNPL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |