C11H19F3N2 — CID 121185701
5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 121185701) has the molecular formula C11H19F3N2 and a molecular weight of 236.28 g/mol. Its IUPAC name is 5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 121185701 |
| Molecular Formula | C11H19F3N2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC(C)N1CC2CN(CC(F)(F)F)CC2C1 |
| InChI | InChI=1S/C11H19F3N2/c1-8(2)16-5-9-3-15(4-10(9)6-16)7-11(12,13)14/h8-10H,3-7H2,1-2H3 |
| InChIKey | VEHNMHVCKLTINA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |