C13H21F3N2 — CID 121185703
5-cyclopentyl-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 121185703) has the molecular formula C13H21F3N2 and a molecular weight of 262.32 g/mol. Its IUPAC name is 5-cyclopentyl-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-cyclopentyl-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 121185703 |
| Molecular Formula | C13H21F3N2 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 5-cyclopentyl-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | FC(F)(F)CN1CC2CN(C3CCCC3)CC2C1 |
| InChI | InChI=1S/C13H21F3N2/c14-13(15,16)9-17-5-10-7-18(8-11(10)6-17)12-3-1-2-4-12/h10-12H,1-9H2 |
| InChIKey | OAUXGVLZGYFFBY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |