C10H17F3N2O — CID 121185704
2-[5-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethanol (PubChem CID 121185704) has the molecular formula C10H17F3N2O and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-[5-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethanol.
| Compound Name | 2-[5-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethanol |
|---|---|
| PubChem CID | 121185704 |
| Molecular Formula | C10H17F3N2O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 2-[5-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethanol |
| SMILES | OCCN1CC2CN(CC(F)(F)F)CC2C1 |
| InChI | InChI=1S/C10H17F3N2O/c11-10(12,13)7-15-5-8-3-14(1-2-16)4-9(8)6-15/h8-9,16H,1-7H2 |
| InChIKey | DZPBVFHKMZTRPP-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |