C13H16F3N3 — CID 121185716
5-pyridin-2-yl-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 121185716) has the molecular formula C13H16F3N3 and a molecular weight of 271.29 g/mol. Its IUPAC name is 5-pyridin-2-yl-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-pyridin-2-yl-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 121185716 |
| Molecular Formula | C13H16F3N3 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 5-pyridin-2-yl-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | FC(F)(F)CN1CC2CN(c3ccccn3)CC2C1 |
| InChI | InChI=1S/C13H16F3N3/c14-13(15,16)9-18-5-10-7-19(8-11(10)6-18)12-3-1-2-4-17-12/h1-4,10-11H,5-9H2 |
| InChIKey | NBXHKGDLTQCMSE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |