C14H25F3N2 — CID 121185728
2-(3,3-dimethylbutyl)-5-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 121185728) has the molecular formula C14H25F3N2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-(3,3-dimethylbutyl)-5-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 2-(3,3-dimethylbutyl)-5-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 121185728 |
| Molecular Formula | C14H25F3N2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 2-(3,3-dimethylbutyl)-5-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC(C)(C)CCN1CC2CN(CC(F)(F)F)CC2C1 |
| InChI | InChI=1S/C14H25F3N2/c1-13(2,3)4-5-18-6-11-8-19(9-12(11)7-18)10-14(15,16)17/h11-12H,4-10H2,1-3H3 |
| InChIKey | NQEWCZGZQSUCRP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |