C20H21BrN2O3 — CID 121185946
(2-bromo-5-methoxyphenyl)-(3-pyridin-3-yloxy-8-azabicyclo[3.2.1]octan-8-yl)methanone (PubChem CID 121185946) has the molecular formula C20H21BrN2O3 and a molecular weight of 417.30 g/mol. Its IUPAC name is (2-bromo-5-methoxyphenyl)-(3-pyridin-3-yloxy-8-azabicyclo[3.2.1]octan-8-yl)methanone.
| Compound Name | (2-bromo-5-methoxyphenyl)-(3-pyridin-3-yloxy-8-azabicyclo[3.2.1]octan-8-yl)methanone |
|---|---|
| PubChem CID | 121185946 |
| Molecular Formula | C20H21BrN2O3 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | (2-bromo-5-methoxyphenyl)-(3-pyridin-3-yloxy-8-azabicyclo[3.2.1]octan-8-yl)methanone |
| SMILES | COc1ccc(Br)c(C(=O)N2C3CCC2CC(Oc2cccnc2)C3)c1 |
| InChI | InChI=1S/C20H21BrN2O3/c1-25-15-6-7-19(21)18(11-15)20(24)23-13-4-5-14(23)10-17(9-13)26-16-3-2-8-22-12-16/h2-3,6-8,11-14,17H,4-5,9-10H2,1H3 |
| InChIKey | NVQVZEWWTKJOAV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |