C20H23N3O5S — CID 121186296
2-methoxy-5-[(3-pyridin-3-yloxy-8-azabicyclo[3.2.1]octan-8-yl)sulfonyl]benzamide (PubChem CID 121186296) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-methoxy-5-[(3-pyridin-3-yloxy-8-azabicyclo[3.2.1]octan-8-yl)sulfonyl]benzamide.
| Compound Name | 2-methoxy-5-[(3-pyridin-3-yloxy-8-azabicyclo[3.2.1]octan-8-yl)sulfonyl]benzamide |
|---|---|
| PubChem CID | 121186296 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-methoxy-5-[(3-pyridin-3-yloxy-8-azabicyclo[3.2.1]octan-8-yl)sulfonyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)N2C3CCC2CC(Oc2cccnc2)C3)cc1C(N)=O |
| InChI | InChI=1S/C20H23N3O5S/c1-27-19-7-6-17(11-18(19)20(21)24)29(25,26)23-13-4-5-14(23)10-16(9-13)28-15-3-2-8-22-12-15/h2-3,6-8,11-14,16H,4-5,9-10H2,1H3,(H2,21,24) |
| InChIKey | UUUOTMJEWATLIM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |