C19H19ClN2O2 — CID 121186471
(2-chlorophenyl)-(3-pyridin-4-yloxy-8-azabicyclo[3.2.1]octan-8-yl)methanone (PubChem CID 121186471) has the molecular formula C19H19ClN2O2 and a molecular weight of 342.83 g/mol. Its IUPAC name is (2-chlorophenyl)-(3-pyridin-4-yloxy-8-azabicyclo[3.2.1]octan-8-yl)methanone.
| Compound Name | (2-chlorophenyl)-(3-pyridin-4-yloxy-8-azabicyclo[3.2.1]octan-8-yl)methanone |
|---|---|
| PubChem CID | 121186471 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (2-chlorophenyl)-(3-pyridin-4-yloxy-8-azabicyclo[3.2.1]octan-8-yl)methanone |
| SMILES | O=C(c1ccccc1Cl)N1C2CCC1CC(Oc1ccncc1)C2 |
| InChI | InChI=1S/C19H19ClN2O2/c20-18-4-2-1-3-17(18)19(23)22-13-5-6-14(22)12-16(11-13)24-15-7-9-21-10-8-15/h1-4,7-10,13-14,16H,5-6,11-12H2 |
| InChIKey | LLRVBFKHUNCCAG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |