C15H16F2N2O — CID 121187174
4-cyclopropylidene-N-(2,6-difluorophenyl)piperidine-1-carboxamide (PubChem CID 121187174) has the molecular formula C15H16F2N2O and a molecular weight of 278.30 g/mol. Its IUPAC name is 4-cyclopropylidene-N-(2,6-difluorophenyl)piperidine-1-carboxamide.
| Compound Name | 4-cyclopropylidene-N-(2,6-difluorophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 121187174 |
| Molecular Formula | C15H16F2N2O |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 4-cyclopropylidene-N-(2,6-difluorophenyl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1c(F)cccc1F)N1CCC(=C2CC2)CC1 |
| InChI | InChI=1S/C15H16F2N2O/c16-12-2-1-3-13(17)14(12)18-15(20)19-8-6-11(7-9-19)10-4-5-10/h1-3H,4-9H2,(H,18,20) |
| InChIKey | LUMWCASLHSQNIB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|