About (3-phenyl-2,1-benzoxazol-5-yl)-[3-(pyrimidin-2-ylamino)azetidin-1-yl]methanone
(3-phenyl-2,1-benzoxazol-5-yl)-[3-(pyrimidin-2-ylamino)azetidin-1-yl]methanone (PubChem CID 121187438) has the molecular formula C21H17N5O2
and a molecular weight of 371.40 g/mol. Its IUPAC name is (3-phenyl-2,1-benzoxazol-5-yl)-[3-(pyrimidin-2-ylamino)azetidin-1-yl]methanone.
Molecular Properties
| Compound Name | (3-phenyl-2,1-benzoxazol-5-yl)-[3-(pyrimidin-2-ylamino)azetidin-1-yl]methanone |
| PubChem CID | 121187438 |
| Molecular Formula | C21H17N5O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | (3-phenyl-2,1-benzoxazol-5-yl)-[3-(pyrimidin-2-ylamino)azetidin-1-yl]methanone |
| SMILES | O=C(c1ccc2noc(-c3ccccc3)c2c1)N1CC(Nc2ncccn2)C1 |
| InChI | InChI=1S/C21H17N5O2/c27-20(26-12-16(13-26)24-21-22-9-4-10-23-21)15-7-8-18-17(11-15)19(28-25-18)14-5-2-1-3-6-14/h1-11,16H,12-13H2,(H,22,23,24) |
| InChIKey | WVGOWBHYBHRWEL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-phenyl-2,1-benzoxazol-5-yl)-[3-(pyrimidin-2-ylamino)azetidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenyl-2,1-benzoxazol-5-yl)-[3-(pyrimidin-2-ylamino)azetidin-1-yl]methanone?
The IUPAC name of (3-phenyl-2,1-benzoxazol-5-yl)-[3-(pyrimidin-2-ylamino)azetidin-1-yl]methanone (CID 121187438) is (3-phenyl-2,1-benzoxazol-5-yl)-[3-(pyrimidin-2-ylamino)azetidin-1-yl]methanone.
What is the SMILES notation for (3-phenyl-2,1-benzoxazol-5-yl)-[3-(pyrimidin-2-ylamino)azetidin-1-yl]methanone?
The canonical SMILES for (3-phenyl-2,1-benzoxazol-5-yl)-[3-(pyrimidin-2-ylamino)azetidin-1-yl]methanone is O=C(c1ccc2noc(-c3ccccc3)c2c1)N1CC(Nc2ncccn2)C1.
What is the InChIKey of (3-phenyl-2,1-benzoxazol-5-yl)-[3-(pyrimidin-2-ylamino)azetidin-1-yl]methanone?
The InChIKey is WVGOWBHYBHRWEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N5O2/c27-20(26-12-16(13-26)24-21-22-9-4-10-23-21)15-7-8-18-17(11-15)19(28-25-18)14-5-2-1-3-6-14/h1-11,16H,12-13H2,(H,22,23,24).
What are the key properties of (3-phenyl-2,1-benzoxazol-5-yl)-[3-(pyrimidin-2-ylamino)azetidin-1-yl]methanone?
(3-phenyl-2,1-benzoxazol-5-yl)-[3-(pyrimidin-2-ylamino)azetidin-1-yl]methanone has a molecular weight of 371.40 g/mol, XLogP of 3.22, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenyl-2,1-benzoxazol-5-yl)-[3-(pyrimidin-2-ylamino)azetidin-1-yl]methanone is sourced from PubChem (CID 121187438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).