About 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl-(4-fluorophenyl)methanone
5,7-dihydropyrrolo[3,4-b]pyridin-6-yl-(4-fluorophenyl)methanone (PubChem CID 121190848) has the molecular formula C14H11FN2O
and a molecular weight of 242.25 g/mol. Its IUPAC name is 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl-(4-fluorophenyl)methanone.
Molecular Properties
| Compound Name | 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl-(4-fluorophenyl)methanone |
| PubChem CID | 121190848 |
| Molecular Formula | C14H11FN2O |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)N1Cc2cccnc2C1 |
| InChI | InChI=1S/C14H11FN2O/c15-12-5-3-10(4-6-12)14(18)17-8-11-2-1-7-16-13(11)9-17/h1-7H,8-9H2 |
| InChIKey | HXYKSUAFBPQVKF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl-(4-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl-(4-fluorophenyl)methanone?
The IUPAC name of 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl-(4-fluorophenyl)methanone (CID 121190848) is 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl-(4-fluorophenyl)methanone.
What is the SMILES notation for 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl-(4-fluorophenyl)methanone?
The canonical SMILES for 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl-(4-fluorophenyl)methanone is O=C(c1ccc(F)cc1)N1Cc2cccnc2C1.
What is the InChIKey of 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl-(4-fluorophenyl)methanone?
The InChIKey is HXYKSUAFBPQVKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11FN2O/c15-12-5-3-10(4-6-12)14(18)17-8-11-2-1-7-16-13(11)9-17/h1-7H,8-9H2.
What are the key properties of 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl-(4-fluorophenyl)methanone?
5,7-dihydropyrrolo[3,4-b]pyridin-6-yl-(4-fluorophenyl)methanone has a molecular weight of 242.25 g/mol, XLogP of 2.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dihydropyrrolo[3,4-b]pyridin-6-yl-(4-fluorophenyl)methanone is sourced from PubChem (CID 121190848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).