C20H23N3O4S3 — CID 121191342
12-[2-(1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl)-2-oxoethyl]-10-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),8-dien-2-one (PubChem CID 121191342) has the molecular formula C20H23N3O4S3 and a molecular weight of 465.62 g/mol. Its IUPAC name is 12-[2-(1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl)-2-oxoethyl]-10-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),8-dien-2-one.
| Compound Name | 12-[2-(1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl)-2-oxoethyl]-10-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),8-dien-2-one |
|---|---|
| PubChem CID | 121191342 |
| Molecular Formula | C20H23N3O4S3 |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 12-[2-(1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl)-2-oxoethyl]-10-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),8-dien-2-one |
| SMILES | O=C(CC1CSc2nc3c(c(=O)n21)CCC3)N1CCC(c2cccs2)S(=O)(=O)CC1 |
| InChI | InChI=1S/C20H23N3O4S3/c24-18(22-7-6-17(16-5-2-9-28-16)30(26,27)10-8-22)11-13-12-29-20-21-15-4-1-3-14(15)19(25)23(13)20/h2,5,9,13,17H,1,3-4,6-8,10-12H2 |
| InChIKey | QUWMQRPEJJACGK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 89.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |