C16H16N2O5S2 — CID 121191408
(1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl)-(3-nitrophenyl)methanone (PubChem CID 121191408) has the molecular formula C16H16N2O5S2 and a molecular weight of 380.45 g/mol. Its IUPAC name is (1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl)-(3-nitrophenyl)methanone.
| Compound Name | (1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl)-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 121191408 |
| Molecular Formula | C16H16N2O5S2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | (1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl)-(3-nitrophenyl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N1CCC(c2cccs2)S(=O)(=O)CC1 |
| InChI | InChI=1S/C16H16N2O5S2/c19-16(12-3-1-4-13(11-12)18(20)21)17-7-6-15(14-5-2-9-24-14)25(22,23)10-8-17/h1-5,9,11,15H,6-8,10H2 |
| InChIKey | RVCCDEWVSBPXNR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|