C17H21NO5S3 — CID 121191701
4-(2-ethoxyphenyl)sulfonyl-7-thiophen-2-yl-1,4-thiazepane 1,1-dioxide (PubChem CID 121191701) has the molecular formula C17H21NO5S3 and a molecular weight of 415.56 g/mol. Its IUPAC name is 4-(2-ethoxyphenyl)sulfonyl-7-thiophen-2-yl-1,4-thiazepane 1,1-dioxide.
| Compound Name | 4-(2-ethoxyphenyl)sulfonyl-7-thiophen-2-yl-1,4-thiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 121191701 |
| Molecular Formula | C17H21NO5S3 |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 4-(2-ethoxyphenyl)sulfonyl-7-thiophen-2-yl-1,4-thiazepane 1,1-dioxide |
| SMILES | CCOc1ccccc1S(=O)(=O)N1CCC(c2cccs2)S(=O)(=O)CC1 |
| InChI | InChI=1S/C17H21NO5S3/c1-2-23-14-6-3-4-8-16(14)26(21,22)18-10-9-17(15-7-5-12-24-15)25(19,20)13-11-18/h3-8,12,17H,2,9-11,13H2,1H3 |
| InChIKey | XOSAXIKCRLJTHB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |