C18H17ClN2O5S — CID 121191876
(5-chloro-2-nitrophenyl)-(1,1-dioxo-7-phenyl-1,4-thiazepan-4-yl)methanone (PubChem CID 121191876) has the molecular formula C18H17ClN2O5S and a molecular weight of 408.86 g/mol. Its IUPAC name is (5-chloro-2-nitrophenyl)-(1,1-dioxo-7-phenyl-1,4-thiazepan-4-yl)methanone.
| Compound Name | (5-chloro-2-nitrophenyl)-(1,1-dioxo-7-phenyl-1,4-thiazepan-4-yl)methanone |
|---|---|
| PubChem CID | 121191876 |
| Molecular Formula | C18H17ClN2O5S |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | (5-chloro-2-nitrophenyl)-(1,1-dioxo-7-phenyl-1,4-thiazepan-4-yl)methanone |
| SMILES | O=C(c1cc(Cl)ccc1[N+](=O)[O-])N1CCC(c2ccccc2)S(=O)(=O)CC1 |
| InChI | InChI=1S/C18H17ClN2O5S/c19-14-6-7-16(21(23)24)15(12-14)18(22)20-9-8-17(27(25,26)11-10-20)13-4-2-1-3-5-13/h1-7,12,17H,8-11H2 |
| InChIKey | VFTRYOBNOISTPC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|