C17H18N4O2S — CID 121196562
4-methyl-N-[[5-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]benzenesulfonamide (PubChem CID 121196562) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 4-methyl-N-[[5-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[[5-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121196562 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 4-methyl-N-[[5-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2cncc(-c3cnn(C)c3)c2)cc1 |
| InChI | InChI=1S/C17H18N4O2S/c1-13-3-5-17(6-4-13)24(22,23)20-9-14-7-15(10-18-8-14)16-11-19-21(2)12-16/h3-8,10-12,20H,9H2,1-2H3 |
| InChIKey | PVEZULGZICMYOK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |