C20H16N2O3S — CID 121197322
N-[[5-(furan-2-yl)-3-pyridinyl]methyl]naphthalene-2-sulfonamide (PubChem CID 121197322) has the molecular formula C20H16N2O3S and a molecular weight of 364.43 g/mol. Its IUPAC name is N-[[5-(furan-2-yl)-3-pyridinyl]methyl]naphthalene-2-sulfonamide.
| Compound Name | N-[[5-(furan-2-yl)-3-pyridinyl]methyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 121197322 |
| Molecular Formula | C20H16N2O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-[[5-(furan-2-yl)-3-pyridinyl]methyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NCc1cncc(-c2ccco2)c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H16N2O3S/c23-26(24,19-8-7-16-4-1-2-5-17(16)11-19)22-13-15-10-18(14-21-12-15)20-6-3-9-25-20/h1-12,14,22H,13H2 |
| InChIKey | IECDDRPRPXJBSS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |