C19H24N6O — CID 121198143
1-(1-adamantyl)-3-[(1-pyridin-3-yltriazol-4-yl)methyl]urea (PubChem CID 121198143) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[(1-pyridin-3-yltriazol-4-yl)methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[(1-pyridin-3-yltriazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 121198143 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 1-(1-adamantyl)-3-[(1-pyridin-3-yltriazol-4-yl)methyl]urea |
| SMILES | O=C(NCc1cn(-c2cccnc2)nn1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H24N6O/c26-18(22-19-7-13-4-14(8-19)6-15(5-13)9-19)21-10-16-12-25(24-23-16)17-2-1-3-20-11-17/h1-3,11-15H,4-10H2,(H2,21,22,26) |
| InChIKey | QIXDCYAHYAQPRZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |