C11H8F2N2O2 — CID 121199579
4-[(2,4-difluorophenyl)methyl]-1H-pyrazine-2,3-dione (PubChem CID 121199579) has the molecular formula C11H8F2N2O2 and a molecular weight of 238.19 g/mol. Its IUPAC name is 4-[(2,4-difluorophenyl)methyl]-1H-pyrazine-2,3-dione.
| Compound Name | 4-[(2,4-difluorophenyl)methyl]-1H-pyrazine-2,3-dione |
|---|---|
| PubChem CID | 121199579 |
| Molecular Formula | C11H8F2N2O2 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 4-[(2,4-difluorophenyl)methyl]-1H-pyrazine-2,3-dione |
| SMILES | O=c1[nH]ccn(Cc2ccc(F)cc2F)c1=O |
| InChI | InChI=1S/C11H8F2N2O2/c12-8-2-1-7(9(13)5-8)6-15-4-3-14-10(16)11(15)17/h1-5H,6H2,(H,14,16) |
| InChIKey | IXBOUUGSDHDIPO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|