C10H13NO3S — CID 121199663
1-ethyl-2,2-dioxo-3,4-dihydro-2λ6,1-benzothiazin-4-ol (PubChem CID 121199663) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is 1-ethyl-2,2-dioxo-3,4-dihydro-2λ6,1-benzothiazin-4-ol.
| Compound Name | 1-ethyl-2,2-dioxo-3,4-dihydro-2λ6,1-benzothiazin-4-ol |
|---|---|
| PubChem CID | 121199663 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 1-ethyl-2,2-dioxo-3,4-dihydro-2λ6,1-benzothiazin-4-ol |
| SMILES | CCN1c2ccccc2C(O)CS1(=O)=O |
| InChI | InChI=1S/C10H13NO3S/c1-2-11-9-6-4-3-5-8(9)10(12)7-15(11,13)14/h3-6,10,12H,2,7H2,1H3 |
| InChIKey | COBZJTXAGZYYNA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |