C10H16ClF2NO — CID 121202485
2-chloro-1-[4-(1,1-difluoroethyl)piperidin-1-yl]propan-1-one (PubChem CID 121202485) has the molecular formula C10H16ClF2NO and a molecular weight of 239.69 g/mol. Its IUPAC name is 2-chloro-1-[4-(1,1-difluoroethyl)piperidin-1-yl]propan-1-one.
| Compound Name | 2-chloro-1-[4-(1,1-difluoroethyl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 121202485 |
| Molecular Formula | C10H16ClF2NO |
| Molecular Weight | 239.69 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 2-chloro-1-[4-(1,1-difluoroethyl)piperidin-1-yl]propan-1-one |
| SMILES | CC(Cl)C(=O)N1CCC(C(C)(F)F)CC1 |
| InChI | InChI=1S/C10H16ClF2NO/c1-7(11)9(15)14-5-3-8(4-6-14)10(2,12)13/h7-8H,3-6H2,1-2H3 |
| InChIKey | NSQZKJJBEOJRCV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.69 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|