C26H23N5S — CID 1212037
3-[2-(4,5-diphenylimidazol-1-yl)ethyl]-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 1212037) has the molecular formula C26H23N5S and a molecular weight of 437.57 g/mol. Its IUPAC name is 3-[2-(4,5-diphenylimidazol-1-yl)ethyl]-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[2-(4,5-diphenylimidazol-1-yl)ethyl]-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 1212037 |
| Molecular Formula | C26H23N5S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 3-[2-(4,5-diphenylimidazol-1-yl)ethyl]-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccc(-n2c(CCn3cnc(-c4ccccc4)c3-c3ccccc3)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C26H23N5S/c1-19-12-14-22(15-13-19)31-23(28-29-26(31)32)16-17-30-18-27-24(20-8-4-2-5-9-20)25(30)21-10-6-3-7-11-21/h2-15,18H,16-17H2,1H3,(H,29,32) |
| InChIKey | JEJPUUMSGYHSLO-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|