About [1-(2-aminoethyl)-4,4-difluoropyrrolidin-2-yl]methanol
[1-(2-aminoethyl)-4,4-difluoropyrrolidin-2-yl]methanol (PubChem CID 121204063) has the molecular formula C7H14F2N2O
and a molecular weight of 180.20 g/mol. Its IUPAC name is [1-(2-aminoethyl)-4,4-difluoropyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [1-(2-aminoethyl)-4,4-difluoropyrrolidin-2-yl]methanol |
| PubChem CID | 121204063 |
| Molecular Formula | C7H14F2N2O |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | [1-(2-aminoethyl)-4,4-difluoropyrrolidin-2-yl]methanol |
| SMILES | NCCN1CC(F)(F)CC1CO |
| InChI | InChI=1S/C7H14F2N2O/c8-7(9)3-6(4-12)11(5-7)2-1-10/h6,12H,1-5,10H2 |
| InChIKey | IAKYMXWMMXZJTE-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(2-aminoethyl)-4,4-difluoropyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2-aminoethyl)-4,4-difluoropyrrolidin-2-yl]methanol?
The IUPAC name of [1-(2-aminoethyl)-4,4-difluoropyrrolidin-2-yl]methanol (CID 121204063) is [1-(2-aminoethyl)-4,4-difluoropyrrolidin-2-yl]methanol.
What is the SMILES notation for [1-(2-aminoethyl)-4,4-difluoropyrrolidin-2-yl]methanol?
The canonical SMILES for [1-(2-aminoethyl)-4,4-difluoropyrrolidin-2-yl]methanol is NCCN1CC(F)(F)CC1CO.
What is the InChIKey of [1-(2-aminoethyl)-4,4-difluoropyrrolidin-2-yl]methanol?
The InChIKey is IAKYMXWMMXZJTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F2N2O/c8-7(9)3-6(4-12)11(5-7)2-1-10/h6,12H,1-5,10H2.
What are the key properties of [1-(2-aminoethyl)-4,4-difluoropyrrolidin-2-yl]methanol?
[1-(2-aminoethyl)-4,4-difluoropyrrolidin-2-yl]methanol has a molecular weight of 180.20 g/mol, XLogP of -0.35, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2-aminoethyl)-4,4-difluoropyrrolidin-2-yl]methanol is sourced from PubChem (CID 121204063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).