About 3-chloro-N-(2,2-diethoxyethyl)pyrazin-2-amine
3-chloro-N-(2,2-diethoxyethyl)pyrazin-2-amine (PubChem CID 121204701) has the molecular formula C10H16ClN3O2
and a molecular weight of 245.71 g/mol. Its IUPAC name is 3-chloro-N-(2,2-diethoxyethyl)pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-chloro-N-(2,2-diethoxyethyl)pyrazin-2-amine |
| PubChem CID | 121204701 |
| Molecular Formula | C10H16ClN3O2 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 3-chloro-N-(2,2-diethoxyethyl)pyrazin-2-amine |
| SMILES | CCOC(CNc1nccnc1Cl)OCC |
| InChI | InChI=1S/C10H16ClN3O2/c1-3-15-8(16-4-2)7-14-10-9(11)12-5-6-13-10/h5-6,8H,3-4,7H2,1-2H3,(H,13,14) |
| InChIKey | URAYPMRWVAHETF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-(2,2-diethoxyethyl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(2,2-diethoxyethyl)pyrazin-2-amine?
The IUPAC name of 3-chloro-N-(2,2-diethoxyethyl)pyrazin-2-amine (CID 121204701) is 3-chloro-N-(2,2-diethoxyethyl)pyrazin-2-amine.
What is the SMILES notation for 3-chloro-N-(2,2-diethoxyethyl)pyrazin-2-amine?
The canonical SMILES for 3-chloro-N-(2,2-diethoxyethyl)pyrazin-2-amine is CCOC(CNc1nccnc1Cl)OCC.
What is the InChIKey of 3-chloro-N-(2,2-diethoxyethyl)pyrazin-2-amine?
The InChIKey is URAYPMRWVAHETF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClN3O2/c1-3-15-8(16-4-2)7-14-10-9(11)12-5-6-13-10/h5-6,8H,3-4,7H2,1-2H3,(H,13,14).
What are the key properties of 3-chloro-N-(2,2-diethoxyethyl)pyrazin-2-amine?
3-chloro-N-(2,2-diethoxyethyl)pyrazin-2-amine has a molecular weight of 245.71 g/mol, XLogP of 1.94, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(2,2-diethoxyethyl)pyrazin-2-amine is sourced from PubChem (CID 121204701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).